C27H38N4O3 — CID 42855971
(4-benzylpiperidin-1-yl)-[2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazol-4-yl]methanone (PubChem CID 42855971) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazol-4-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 42855971 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazol-4-yl]methanone |
| SMILES | C=CCCC(O)CN1CCN(Cc2nc(C(=O)N3CCC(Cc4ccccc4)CC3)co2)CC1 |
| InChI | InChI=1S/C27H38N4O3/c1-2-3-9-24(32)19-29-14-16-30(17-15-29)20-26-28-25(21-34-26)27(33)31-12-10-23(11-13-31)18-22-7-5-4-6-8-22/h2,4-8,21,23-24,32H,1,3,9-20H2 |
| InChIKey | VMINTKNWJKTXKD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|