C21H27ClN4O3 — CID 92986502
N-(4-chlorophenyl)-2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 92986502) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 92986502 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CCC[C@@H](O)CN1CCN(Cc2nc(C(=O)Nc3ccc(Cl)cc3)co2)CC1 |
| InChI | InChI=1S/C21H27ClN4O3/c1-2-3-4-18(27)13-25-9-11-26(12-10-25)14-20-24-19(15-29-20)21(28)23-17-7-5-16(22)6-8-17/h2,5-8,15,18,27H,1,3-4,9-14H2,(H,23,28)/t18-/m1/s1 |
| InChIKey | ARHBIXFNNFPXHS-GOSISDBHSA-N |
| XLogP | 3.03 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|