C22H29FN4O3 — CID 92986326
N-(2-fluoro-5-methylphenyl)-2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 92986326) has the molecular formula C22H29FN4O3 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-(2-fluoro-5-methylphenyl)-2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-fluoro-5-methylphenyl)-2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 92986326 |
| Molecular Formula | C22H29FN4O3 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-(2-fluoro-5-methylphenyl)-2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CCC[C@H](O)CN1CCN(Cc2nc(C(=O)Nc3cc(C)ccc3F)co2)CC1 |
| InChI | InChI=1S/C22H29FN4O3/c1-3-4-5-17(28)13-26-8-10-27(11-9-26)14-21-24-20(15-30-21)22(29)25-19-12-16(2)6-7-18(19)23/h3,6-7,12,15,17,28H,1,4-5,8-11,13-14H2,2H3,(H,25,29)/t17-/m0/s1 |
| InChIKey | ZNVBLJMIUFZAAO-KRWDZBQOSA-N |
| XLogP | 2.82 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|