C22H30N4O4 — CID 92986813
2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 92986813) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 92986813 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-[[4-[(2R)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | C=CCC[C@@H](O)CN1CCN(Cc2nc(C(=O)Nc3ccc(OC)cc3)co2)CC1 |
| InChI | InChI=1S/C22H30N4O4/c1-3-4-5-18(27)14-25-10-12-26(13-11-25)15-21-24-20(16-30-21)22(28)23-17-6-8-19(29-2)9-7-17/h3,6-9,16,18,27H,1,4-5,10-15H2,2H3,(H,23,28)/t18-/m1/s1 |
| InChIKey | IPUOPMHQEIGXPC-GOSISDBHSA-N |
| XLogP | 2.38 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|