C24H34N4O4 — CID 92986554
2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 92986554) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 92986554 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[[4-[(2S)-2-hydroxyhex-5-enyl]piperazin-1-yl]methyl]-N-[2-(2-methoxyphenyl)ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CCC[C@H](O)CN1CCN(Cc2nc(C(=O)NCCc3ccccc3OC)co2)CC1 |
| InChI | InChI=1S/C24H34N4O4/c1-3-4-8-20(29)16-27-12-14-28(15-13-27)17-23-26-21(18-32-23)24(30)25-11-10-19-7-5-6-9-22(19)31-2/h3,5-7,9,18,20,29H,1,4,8,10-17H2,2H3,(H,25,30)/t20-/m0/s1 |
| InChIKey | HTSHQTVAOBHCLR-FQEVSTJZSA-N |
| XLogP | 2.10 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|