C22H29FN4O3 — CID 46051293
N-[(4-fluorophenyl)methyl]-2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 46051293) has the molecular formula C22H29FN4O3 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46051293 |
| Molecular Formula | C22H29FN4O3 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[[4-(2-hydroxyhex-5-enyl)piperazin-1-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CCCC(O)CN1CCN(Cc2nc(C(=O)NCc3ccc(F)cc3)co2)CC1 |
| InChI | InChI=1S/C22H29FN4O3/c1-2-3-4-19(28)14-26-9-11-27(12-10-26)15-21-25-20(16-30-21)22(29)24-13-17-5-7-18(23)8-6-17/h2,5-8,16,19,28H,1,3-4,9-15H2,(H,24,29) |
| InChIKey | SCKATCOPESMHRG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|