C20H27FN4O4 — CID 42868332
2-[4-(4-fluorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 42868332) has the molecular formula C20H27FN4O4 and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | 2-[4-(4-fluorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 42868332 |
| Molecular Formula | C20H27FN4O4 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-2,6-dioxo-1,3-diazinan-1-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | CC(C(=O)NCCCN1CCOCC1)N1C(=O)CC(c2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C20H27FN4O4/c1-14(19(27)22-7-2-8-24-9-11-29-12-10-24)25-18(26)13-17(23-20(25)28)15-3-5-16(21)6-4-15/h3-6,14,17H,2,7-13H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | FBHNUWJAKWIYNQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|