C20H17FN2O4 — CID 4288481
N-(3-fluorophenyl)-8-methoxy-5-oxo-2,4-dihydro-1H-chromeno[3,4-c]pyridine-3-carboxamide (PubChem CID 4288481) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is N-(3-fluorophenyl)-8-methoxy-5-oxo-2,4-dihydro-1H-chromeno[3,4-c]pyridine-3-carboxamide.
| Compound Name | N-(3-fluorophenyl)-8-methoxy-5-oxo-2,4-dihydro-1H-chromeno[3,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4288481 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-(3-fluorophenyl)-8-methoxy-5-oxo-2,4-dihydro-1H-chromeno[3,4-c]pyridine-3-carboxamide |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)CN(C(=O)Nc1cccc(F)c1)CC3 |
| InChI | InChI=1S/C20H17FN2O4/c1-26-14-5-6-16-15-7-8-23(11-17(15)19(24)27-18(16)10-14)20(25)22-13-4-2-3-12(21)9-13/h2-6,9-10H,7-8,11H2,1H3,(H,22,25) |
| InChIKey | OJONWZQCCNMAGW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|