C22H30BrN3O2 — CID 42894383
2-(3-bromo-1-adamantyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide (PubChem CID 42894383) has the molecular formula C22H30BrN3O2 and a molecular weight of 448.41 g/mol. Its IUPAC name is 2-(3-bromo-1-adamantyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide.
| Compound Name | 2-(3-bromo-1-adamantyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 42894383 |
| Molecular Formula | C22H30BrN3O2 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-(3-bromo-1-adamantyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(Br)(C3)C1)C2)NCc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C22H30BrN3O2/c23-22-10-17-7-18(11-22)9-21(8-17,15-22)12-20(27)25-14-16-1-2-19(24-13-16)26-3-5-28-6-4-26/h1-2,13,17-18H,3-12,14-15H2,(H,25,27) |
| InChIKey | KEKIMSBLHQZEFS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|