C17H16BrNO5 — CID 4290108
[2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 4290108) has the molecular formula C17H16BrNO5 and a molecular weight of 394.22 g/mol. Its IUPAC name is [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4290108 |
| Molecular Formula | C17H16BrNO5 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)COC(=O)C=Cc2ccc(Br)o2)c1C |
| InChI | InChI=1S/C17H16BrNO5/c1-9-16(11(3)20)10(2)19-17(9)13(21)8-23-15(22)7-5-12-4-6-14(18)24-12/h4-7,19H,8H2,1-3H3 |
| InChIKey | ZBLCBSPUZDTLKK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|