About N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide
N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide (PubChem CID 42941371) has the molecular formula C19H17FN2O2S2
and a molecular weight of 388.49 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide.
Molecular Properties
| Compound Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide |
| PubChem CID | 42941371 |
| Molecular Formula | C19H17FN2O2S2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide |
| SMILES | Cc1cnc2c(S(=O)(=O)NC3CCSc4ccc(F)cc43)cccc2c1 |
| InChI | InChI=1S/C19H17FN2O2S2/c1-12-9-13-3-2-4-18(19(13)21-11-12)26(23,24)22-16-7-8-25-17-6-5-14(20)10-15(16)17/h2-6,9-11,16,22H,7-8H2,1H3 |
| InChIKey | BBQCXKNOCLHVBK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide?
The IUPAC name of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide (CID 42941371) is N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide.
What is the SMILES notation for N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide?
The canonical SMILES for N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide is Cc1cnc2c(S(=O)(=O)NC3CCSc4ccc(F)cc43)cccc2c1.
What is the InChIKey of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide?
The InChIKey is BBQCXKNOCLHVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O2S2/c1-12-9-13-3-2-4-18(19(13)21-11-12)26(23,24)22-16-7-8-25-17-6-5-14(20)10-15(16)17/h2-6,9-11,16,22H,7-8H2,1H3.
What are the key properties of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide?
N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide has a molecular weight of 388.49 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylquinoline-8-sulfonamide is sourced from PubChem (CID 42941371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).