C19H25N2O6P — CID 42948661
[(3-methylphenyl)-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]methyl]phosphonic acid;propan-2-ol (PubChem CID 42948661) has the molecular formula C19H25N2O6P and a molecular weight of 408.39 g/mol. Its IUPAC name is [(3-methylphenyl)-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]methyl]phosphonic acid;propan-2-ol.
| Compound Name | [(3-methylphenyl)-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]methyl]phosphonic acid;propan-2-ol |
|---|---|
| PubChem CID | 42948661 |
| Molecular Formula | C19H25N2O6P |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [(3-methylphenyl)-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]methyl]phosphonic acid;propan-2-ol |
| SMILES | CC(C)O.Cc1cccc(C(Nc2ccc3c(c2)NC(=O)CO3)P(=O)(O)O)c1 |
| InChI | InChI=1S/C16H17N2O5P.C3H8O/c1-10-3-2-4-11(7-10)16(24(20,21)22)17-12-5-6-14-13(8-12)18-15(19)9-23-14;1-3(2)4/h2-8,16-17H,9H2,1H3,(H,18,19)(H2,20,21,22);3-4H,1-2H3 |
| InChIKey | YIGKYTCWTQJRPO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|