C20H21ClN2O2 — CID 42950201
3-[(3-chlorophenyl)methyl-methylamino]-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 42950201) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl-methylamino]-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(3-chlorophenyl)methyl-methylamino]-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42950201 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl-methylamino]-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(C)c1N1C(=O)CC(N(C)Cc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C20H21ClN2O2/c1-13-6-4-7-14(2)19(13)23-18(24)11-17(20(23)25)22(3)12-15-8-5-9-16(21)10-15/h4-10,17H,11-12H2,1-3H3 |
| InChIKey | JIIZRJHZCRWDNF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|