C19H24N2O3S — CID 42951546
N-(1,1-dioxothiolan-3-yl)-N-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxamide (PubChem CID 42951546) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxamide |
|---|---|
| PubChem CID | 42951546 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxamide |
| SMILES | CN(C(=O)c1cccc2c3c([nH]c12)CCCCC3)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H24N2O3S/c1-21(13-10-11-25(23,24)12-13)19(22)16-8-5-7-15-14-6-3-2-4-9-17(14)20-18(15)16/h5,7-8,13,20H,2-4,6,9-12H2,1H3 |
| InChIKey | ANUWXJXZGCJSBT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|