C20H31N3O5S — CID 42962136
N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 42962136) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 42962136 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CC(C)CC(NC(=O)c1cccc(S(=O)(=O)NCC2CCCO2)c1)C(=O)N(C)C |
| InChI | InChI=1S/C20H31N3O5S/c1-14(2)11-18(20(25)23(3)4)22-19(24)15-7-5-9-17(12-15)29(26,27)21-13-16-8-6-10-28-16/h5,7,9,12,14,16,18,21H,6,8,10-11,13H2,1-4H3,(H,22,24) |
| InChIKey | SKSQZPSETQUBPE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |