C21H25NO5S — CID 42981551
2-(4-methoxyphenyl)ethyl 2-piperidin-1-ylsulfonylbenzoate (PubChem CID 42981551) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 2-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-(4-methoxyphenyl)ethyl 2-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42981551 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 2-piperidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(CCOC(=O)c2ccccc2S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-26-18-11-9-17(10-12-18)13-16-27-21(23)19-7-3-4-8-20(19)28(24,25)22-14-5-2-6-15-22/h3-4,7-12H,2,5-6,13-16H2,1H3 |
| InChIKey | SBHXKQWMRCRYLG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |