C20H19BrO6 — CID 42998254
3-[(E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione (PubChem CID 42998254) has the molecular formula C20H19BrO6 and a molecular weight of 435.27 g/mol. Its IUPAC name is 3-[(E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione.
| Compound Name | 3-[(E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
|---|---|
| PubChem CID | 42998254 |
| Molecular Formula | C20H19BrO6 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 3-[(E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
| SMILES | C=CCOc1c(Br)cc(/C=C/C(=O)C2C(=O)C=C(C)OC2=O)cc1OCC |
| InChI | InChI=1S/C20H19BrO6/c1-4-8-26-19-14(21)10-13(11-17(19)25-5-2)6-7-15(22)18-16(23)9-12(3)27-20(18)24/h4,6-7,9-11,18H,1,5,8H2,2-3H3/b7-6+ |
| InChIKey | QHAYAISGGUWEPD-VOTSOKGWSA-N |
| XLogP | 3.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|