C20H22O6 — CID 42998258
3-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione (PubChem CID 42998258) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione.
| Compound Name | 3-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
|---|---|
| PubChem CID | 42998258 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-[(E)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
| SMILES | CCCOc1c(/C=C/C(=O)C2C(=O)C=C(C)OC2=O)cccc1OCC |
| InChI | InChI=1S/C20H22O6/c1-4-11-25-19-14(7-6-8-17(19)24-5-2)9-10-15(21)18-16(22)12-13(3)26-20(18)23/h6-10,12,18H,4-5,11H2,1-3H3/b10-9+ |
| InChIKey | FHRSASUEDFXZFR-MDZDMXLPSA-N |
| XLogP | 3.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|