C23H26N2O5 — CID 42999528
(E)-N-(5-acetamido-2-methoxyphenyl)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enamide (PubChem CID 42999528) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (E)-N-(5-acetamido-2-methoxyphenyl)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enamide.
| Compound Name | (E)-N-(5-acetamido-2-methoxyphenyl)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 42999528 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (E)-N-(5-acetamido-2-methoxyphenyl)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enamide |
| SMILES | CCOc1cc2c(cc1/C=C/C(=O)Nc1cc(NC(C)=O)ccc1OC)OC(C)C2 |
| InChI | InChI=1S/C23H26N2O5/c1-5-29-21-12-17-10-14(2)30-22(17)11-16(21)6-9-23(27)25-19-13-18(24-15(3)26)7-8-20(19)28-4/h6-9,11-14H,5,10H2,1-4H3,(H,24,26)(H,25,27)/b9-6+ |
| InChIKey | PIQVIOHMEXTCHR-RMKNXTFCSA-N |
| XLogP | 4.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|