C21H24N2O5S — CID 9141248
(E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide (PubChem CID 9141248) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9141248 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
| SMILES | CCOc1cc2c(cc1/C=C/C(=O)Nc1ccc(C)c(S(N)(=O)=O)c1)O[C@@H](C)C2 |
| InChI | InChI=1S/C21H24N2O5S/c1-4-27-18-11-16-9-14(3)28-19(16)10-15(18)6-8-21(24)23-17-7-5-13(2)20(12-17)29(22,25)26/h5-8,10-12,14H,4,9H2,1-3H3,(H,23,24)(H2,22,25,26)/b8-6+/t14-/m0/s1 |
| InChIKey | UBJYRMGGUICLCE-OWNNVSBGSA-N |
| XLogP | 3.02 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|