C25H30N2O4 — CID 72689351
5-[3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoylamino]-2-methyl-N-propan-2-ylbenzamide (PubChem CID 72689351) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-[3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoylamino]-2-methyl-N-propan-2-ylbenzamide.
| Compound Name | 5-[3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoylamino]-2-methyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 72689351 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-[3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoylamino]-2-methyl-N-propan-2-ylbenzamide |
| SMILES | CCOc1cc2c(cc1C=CC(=O)Nc1ccc(C)c(C(=O)NC(C)C)c1)OC(C)C2 |
| InChI | InChI=1S/C25H30N2O4/c1-6-30-22-13-19-11-17(5)31-23(19)12-18(22)8-10-24(28)27-20-9-7-16(4)21(14-20)25(29)26-15(2)3/h7-10,12-15,17H,6,11H2,1-5H3,(H,26,29)(H,27,28) |
| InChIKey | DEEVNRJWNKBAFY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|