C22H25NO5 — CID 9096781
(E)-N-(3,5-dimethoxyphenyl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enamide (PubChem CID 9096781) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is (E)-N-(3,5-dimethoxyphenyl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enamide.
| Compound Name | (E)-N-(3,5-dimethoxyphenyl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 9096781 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (E)-N-(3,5-dimethoxyphenyl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enamide |
| SMILES | CCOc1cc2c(cc1/C=C/C(=O)Nc1cc(OC)cc(OC)c1)O[C@H](C)C2 |
| InChI | InChI=1S/C22H25NO5/c1-5-27-20-10-16-8-14(2)28-21(16)9-15(20)6-7-22(24)23-17-11-18(25-3)13-19(12-17)26-4/h6-7,9-14H,5,8H2,1-4H3,(H,23,24)/b7-6+/t14-/m1/s1 |
| InChIKey | NRDBLKYSFMKAJW-PSKZRQQASA-N |
| XLogP | 4.08 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|