C23H25NO5 — CID 55339328
methyl 3-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]-4-methylbenzoate (PubChem CID 55339328) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 55339328 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl 3-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]-4-methylbenzoate |
| SMILES | CCOc1cc2c(cc1/C=C/C(=O)Nc1cc(C(=O)OC)ccc1C)OC(C)C2 |
| InChI | InChI=1S/C23H25NO5/c1-5-28-20-13-18-10-15(3)29-21(18)12-16(20)8-9-22(25)24-19-11-17(23(26)27-4)7-6-14(19)2/h6-9,11-13,15H,5,10H2,1-4H3,(H,24,25)/b9-8+ |
| InChIKey | RKVLSGXKTQRFMT-CMDGGOBGSA-N |
| XLogP | 4.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|