C24H26N2O4 — CID 55333089
N-cyclopropyl-2-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]benzamide (PubChem CID 55333089) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is N-cyclopropyl-2-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-cyclopropyl-2-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 55333089 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-cyclopropyl-2-[[(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)prop-2-enoyl]amino]benzamide |
| SMILES | CCOc1cc2c(cc1/C=C/C(=O)Nc1ccccc1C(=O)NC1CC1)OC(C)C2 |
| InChI | InChI=1S/C24H26N2O4/c1-3-29-21-14-17-12-15(2)30-22(17)13-16(21)8-11-23(27)26-20-7-5-4-6-19(20)24(28)25-18-9-10-18/h4-8,11,13-15,18H,3,9-10,12H2,1-2H3,(H,25,28)(H,26,27)/b11-8+ |
| InChIKey | ROSNEOSEQIQGDJ-DHZHZOJOSA-N |
| XLogP | 3.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|