C25H31N3O5S — CID 55395246
(E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide (PubChem CID 55395246) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is (E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55395246 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (E)-3-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide |
| SMILES | CCOc1cc2c(cc1/C=C/C(=O)Nc1ccc(S(=O)(=O)N3CCN(C)CC3)cc1)OC(C)C2 |
| InChI | InChI=1S/C25H31N3O5S/c1-4-32-23-17-20-15-18(2)33-24(20)16-19(23)5-10-25(29)26-21-6-8-22(9-7-21)34(30,31)28-13-11-27(3)12-14-28/h5-10,16-18H,4,11-15H2,1-3H3,(H,26,29)/b10-5+ |
| InChIKey | KSSYDCFAAHJTRR-BJMVGYQFSA-N |
| XLogP | 3.00 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|