C24H29ClN2O5 — CID 43013526
6-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 43013526) has the molecular formula C24H29ClN2O5 and a molecular weight of 460.96 g/mol. Its IUPAC name is 6-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 43013526 |
| Molecular Formula | C24H29ClN2O5 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 6-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C24H29ClN2O5/c1-3-30-22-14-20(27-7-9-29-10-8-27)23(31-4-2)13-19(22)26-24(28)17-11-16-12-18(25)5-6-21(16)32-15-17/h5-6,12-14,17H,3-4,7-11,15H2,1-2H3,(H,26,28) |
| InChIKey | JSWBQNSHQZTMSA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|