C13H10BrN3O2S — CID 43046479
N'-(4-bromobenzoyl)-2-sulfanylidene-1H-pyridine-3-carbohydrazide (PubChem CID 43046479) has the molecular formula C13H10BrN3O2S and a molecular weight of 352.21 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-2-sulfanylidene-1H-pyridine-3-carbohydrazide.
| Compound Name | N'-(4-bromobenzoyl)-2-sulfanylidene-1H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 43046479 |
| Molecular Formula | C13H10BrN3O2S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | N'-(4-bromobenzoyl)-2-sulfanylidene-1H-pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc[nH]c1=S)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H10BrN3O2S/c14-9-5-3-8(4-6-9)11(18)16-17-12(19)10-2-1-7-15-13(10)20/h1-7H,(H,15,20)(H,16,18)(H,17,19) |
| InChIKey | JFRGLASSCVBRMR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|