C21H22ClN5OS2 — CID 43055097
5-[1-(1-benzyl-5-chlorobenzimidazol-2-yl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 43055097) has the molecular formula C21H22ClN5OS2 and a molecular weight of 460.03 g/mol. Its IUPAC name is 5-[1-(1-benzyl-5-chlorobenzimidazol-2-yl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[1-(1-benzyl-5-chlorobenzimidazol-2-yl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 43055097 |
| Molecular Formula | C21H22ClN5OS2 |
| Molecular Weight | 460.03 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 5-[1-(1-benzyl-5-chlorobenzimidazol-2-yl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(SC(C)c2nc3cc(Cl)ccc3n2Cc2ccccc2)s1 |
| InChI | InChI=1S/C21H22ClN5OS2/c1-14(29-21-26-25-20(30-21)23-10-11-28-2)19-24-17-12-16(22)8-9-18(17)27(19)13-15-6-4-3-5-7-15/h3-9,12,14H,10-11,13H2,1-2H3,(H,23,25) |
| InChIKey | NBJWMAYJZSRJTP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.03 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|