C20H17F3N4S2 — CID 4305965
3-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine (PubChem CID 4305965) has the molecular formula C20H17F3N4S2 and a molecular weight of 434.51 g/mol. Its IUPAC name is 3-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine.
| Compound Name | 3-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 4305965 |
| Molecular Formula | C20H17F3N4S2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 3-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine |
| SMILES | Cc1c(-c2nnc3n2CCCCC3)sc2nc(-c3cccs3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C20H17F3N4S2/c1-11-16-12(20(21,22)23)10-13(14-6-5-9-28-14)24-19(16)29-17(11)18-26-25-15-7-3-2-4-8-27(15)18/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | KDAROKQYVRIICO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |