C15H24N2O2S — CID 43100497
5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,3-dimethylaniline (PubChem CID 43100497) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,3-dimethylaniline.
| Compound Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,3-dimethylaniline |
|---|---|
| PubChem CID | 43100497 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,3-dimethylaniline |
| SMILES | Cc1cc(S(=O)(=O)N2CC(C)CC(C)C2)cc(N)c1C |
| InChI | InChI=1S/C15H24N2O2S/c1-10-5-11(2)9-17(8-10)20(18,19)14-6-12(3)13(4)15(16)7-14/h6-7,10-11H,5,8-9,16H2,1-4H3 |
| InChIKey | AQNHUEQCVXQTOF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|