C15H22N2O3S — CID 46406612
5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylbenzamide (PubChem CID 46406612) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylbenzamide.
| Compound Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylbenzamide |
|---|---|
| PubChem CID | 46406612 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)CC(C)C2)cc1C(N)=O |
| InChI | InChI=1S/C15H22N2O3S/c1-10-6-11(2)9-17(8-10)21(19,20)13-5-4-12(3)14(7-13)15(16)18/h4-5,7,10-11H,6,8-9H2,1-3H3,(H2,16,18) |
| InChIKey | YJVOZWKDHOJZSO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |