C17H22N2O3S — CID 58356212
5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1H-indene-2-carboxamide (PubChem CID 58356212) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1H-indene-2-carboxamide.
| Compound Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 58356212 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1H-indene-2-carboxamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc3c(c2)C=C(C(N)=O)C3)C1 |
| InChI | InChI=1S/C17H22N2O3S/c1-11-5-12(2)10-19(9-11)23(21,22)16-4-3-13-6-15(17(18)20)7-14(13)8-16/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3,(H2,18,20) |
| InChIKey | HDNXBCNHXVITOF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |