C10H16O3 — CID 43139069
1-cyclopropyl-5-ethoxypentane-1,3-dione (PubChem CID 43139069) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-cyclopropyl-5-ethoxypentane-1,3-dione.
| Compound Name | 1-cyclopropyl-5-ethoxypentane-1,3-dione |
|---|---|
| PubChem CID | 43139069 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-cyclopropyl-5-ethoxypentane-1,3-dione |
| SMILES | CCOCCC(=O)CC(=O)C1CC1 |
| InChI | InChI=1S/C10H16O3/c1-2-13-6-5-9(11)7-10(12)8-3-4-8/h8H,2-7H2,1H3 |
| InChIKey | RYPVZMRMGNEBPK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|