C8H15N3O3 — CID 43165922
3-[3-(ethylamino)-2-hydroxypropyl]imidazolidine-2,4-dione (PubChem CID 43165922) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-[3-(ethylamino)-2-hydroxypropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-(ethylamino)-2-hydroxypropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43165922 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 3-[3-(ethylamino)-2-hydroxypropyl]imidazolidine-2,4-dione |
| SMILES | CCNCC(O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C8H15N3O3/c1-2-9-3-6(12)5-11-7(13)4-10-8(11)14/h6,9,12H,2-5H2,1H3,(H,10,14) |
| InChIKey | IQIGWGYGGYUIQT-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|