C18H21NO — CID 43189757
1,7-dimethyl-3-(3-methylanilino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 43189757) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 1,7-dimethyl-3-(3-methylanilino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1,7-dimethyl-3-(3-methylanilino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43189757 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1,7-dimethyl-3-(3-methylanilino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1cccc(NC2CC(C)c3c(C)ccc(O)c32)c1 |
| InChI | InChI=1S/C18H21NO/c1-11-5-4-6-14(9-11)19-15-10-13(3)17-12(2)7-8-16(20)18(15)17/h4-9,13,15,19-20H,10H2,1-3H3 |
| InChIKey | WSDHLMNMJCYQDE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|