C10H15NO3S — CID 43286969
4-(4-ethyl-5-methyl-2-oxo-1,3-thiazol-3-yl)butanoic acid (PubChem CID 43286969) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 4-(4-ethyl-5-methyl-2-oxo-1,3-thiazol-3-yl)butanoic acid.
| Compound Name | 4-(4-ethyl-5-methyl-2-oxo-1,3-thiazol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 43286969 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 4-(4-ethyl-5-methyl-2-oxo-1,3-thiazol-3-yl)butanoic acid |
| SMILES | CCc1c(C)sc(=O)n1CCCC(=O)O |
| InChI | InChI=1S/C10H15NO3S/c1-3-8-7(2)15-10(14)11(8)6-4-5-9(12)13/h3-6H2,1-2H3,(H,12,13) |
| InChIKey | DLTKEBCIZWYXHJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |