C14H16ClNOS — CID 43320242
4-(chloromethyl)-2-[2-(1-phenylethoxy)ethyl]-1,3-thiazole (PubChem CID 43320242) has the molecular formula C14H16ClNOS and a molecular weight of 281.81 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[2-(1-phenylethoxy)ethyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[2-(1-phenylethoxy)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43320242 |
| Molecular Formula | C14H16ClNOS |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-(chloromethyl)-2-[2-(1-phenylethoxy)ethyl]-1,3-thiazole |
| SMILES | CC(OCCc1nc(CCl)cs1)c1ccccc1 |
| InChI | InChI=1S/C14H16ClNOS/c1-11(12-5-3-2-4-6-12)17-8-7-14-16-13(9-15)10-18-14/h2-6,10-11H,7-9H2,1H3 |
| InChIKey | ZKJOWTYVNWVBOT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|