C7H14N2O2S — CID 43363341
N-(3-hydroxypropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43363341) has the molecular formula C7H14N2O2S and a molecular weight of 190.27 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43363341 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | N-(3-hydroxypropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCCO)C1CSCN1 |
| InChI | InChI=1S/C7H14N2O2S/c10-3-1-2-8-7(11)6-4-12-5-9-6/h6,9-10H,1-5H2,(H,8,11) |
| InChIKey | BXZCARFLQISGPX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|