C12H20N2OS — CID 43367305
2-amino-N,N-diethyl-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 43367305) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-amino-N,N-diethyl-5-propan-2-ylthiophene-3-carboxamide.
| Compound Name | 2-amino-N,N-diethyl-5-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 43367305 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-amino-N,N-diethyl-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(C(C)C)sc1N |
| InChI | InChI=1S/C12H20N2OS/c1-5-14(6-2)12(15)9-7-10(8(3)4)16-11(9)13/h7-8H,5-6,13H2,1-4H3 |
| InChIKey | VZPFGRQINIPNQY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |