C11H15N3O2 — CID 43397857
6-oxo-N,N-bis(prop-2-enyl)-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 43397857) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 6-oxo-N,N-bis(prop-2-enyl)-4,5-dihydro-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N,N-bis(prop-2-enyl)-4,5-dihydro-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 43397857 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 6-oxo-N,N-bis(prop-2-enyl)-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C11H15N3O2/c1-3-7-14(8-4-2)11(16)9-5-6-10(15)13-12-9/h3-4H,1-2,5-8H2,(H,13,15) |
| InChIKey | GCNJCEQYRPNIOR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|