C11H9N3O5S — CID 43417368
3-methyl-5-[(4-nitro-1H-pyrrole-2-carbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 43417368) has the molecular formula C11H9N3O5S and a molecular weight of 295.28 g/mol. Its IUPAC name is 3-methyl-5-[(4-nitro-1H-pyrrole-2-carbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(4-nitro-1H-pyrrole-2-carbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43417368 |
| Molecular Formula | C11H9N3O5S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-methyl-5-[(4-nitro-1H-pyrrole-2-carbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2cc([N+](=O)[O-])c[nH]2)sc1C(=O)O |
| InChI | InChI=1S/C11H9N3O5S/c1-5-2-8(20-9(5)11(16)17)13-10(15)7-3-6(4-12-7)14(18)19/h2-4,12H,1H3,(H,13,15)(H,16,17) |
| InChIKey | YDKQJPSABNKPNH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|