C8H11N3O3S — CID 43466606
3-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]propanoic acid (PubChem CID 43466606) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]propanoic acid.
| Compound Name | 3-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43466606 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 3-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]amino]propanoic acid |
| SMILES | O=C(O)CCNCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H11N3O3S/c12-6(5-9-2-1-7(13)14)11-8-10-3-4-15-8/h3-4,9H,1-2,5H2,(H,13,14)(H,10,11,12) |
| InChIKey | VEMUYLCAMVZMFY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|