C7H11NO3S — CID 43509837
3-(4-hydroxybutyl)-1,3-thiazolidine-2,4-dione (PubChem CID 43509837) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(4-hydroxybutyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 43509837 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-(4-hydroxybutyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1CCCCO |
| InChI | InChI=1S/C7H11NO3S/c9-4-2-1-3-8-6(10)5-12-7(8)11/h9H,1-5H2 |
| InChIKey | WYAXFFNNECRKAT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|