C6H8ClN3O3S2 — CID 43553616
3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]propanamide (PubChem CID 43553616) has the molecular formula C6H8ClN3O3S2 and a molecular weight of 269.74 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]propanamide.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 43553616 |
| Molecular Formula | C6H8ClN3O3S2 |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]propanamide |
| SMILES | NC(=O)CCNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H8ClN3O3S2/c7-6-9-3-5(14-6)15(12,13)10-2-1-4(8)11/h3,10H,1-2H2,(H2,8,11) |
| InChIKey | CCMUGRMUCNXMLP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |