C10H11FN2O2S2 — CID 43581061
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-6-fluorobenzenecarbothioamide (PubChem CID 43581061) has the molecular formula C10H11FN2O2S2 and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 43581061 |
| Molecular Formula | C10H11FN2O2S2 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1N1CCCS1(=O)=O |
| InChI | InChI=1S/C10H11FN2O2S2/c11-7-3-1-4-8(9(7)10(12)16)13-5-2-6-17(13,14)15/h1,3-4H,2,5-6H2,(H2,12,16) |
| InChIKey | DHAAAVSFVWFIEJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|