2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid

C10H9ClF2O3 — CID 43651972

IUPAC2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid
SMILESCc1cc(OC(F)(F)C(=O)O)cc(C)c1Cl
InChIInChI=1S/C10H9ClF2O3/c1-5-3-7(4-6(2)8(5)11)16-10(12,13)9(14)15/h3-4H,1-2H3,(H,14,15)
InChIKeyRORCJKACSGIYHS-UHFFFAOYSA-N
MW250.63 g/mol
LogP3.01
Rot. Bonds3

About 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid

2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid (PubChem CID 43651972) has the molecular formula C10H9ClF2O3 and a molecular weight of 250.63 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid.

Molecular Properties

Compound Name2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid
PubChem CID43651972
Molecular FormulaC10H9ClF2O3
Molecular Weight250.63 g/mol
Exact Mass250.02
IUPAC Name2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid
SMILESCc1cc(OC(F)(F)C(=O)O)cc(C)c1Cl
InChIInChI=1S/C10H9ClF2O3/c1-5-3-7(4-6(2)8(5)11)16-10(12,13)9(14)15/h3-4H,1-2H3,(H,14,15)
InChIKeyRORCJKACSGIYHS-UHFFFAOYSA-N
XLogP3.01
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.63
LogP ≤ 53.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid?
The IUPAC name of 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid (CID 43651972) is 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid.
What is the SMILES notation for 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid?
The canonical SMILES for 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid is Cc1cc(OC(F)(F)C(=O)O)cc(C)c1Cl.
What is the InChIKey of 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid?
The InChIKey is RORCJKACSGIYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF2O3/c1-5-3-7(4-6(2)8(5)11)16-10(12,13)9(14)15/h3-4H,1-2H3,(H,14,15).
What are the key properties of 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid?
2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid has a molecular weight of 250.63 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3,5-dimethylphenoxy)-2,2-difluoroacetic acid is sourced from PubChem (CID 43651972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).