C16H14N2O2S — CID 43741509
5-(3,4-dihydro-2H-thiochromen-4-ylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 43741509) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-thiochromen-4-ylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(3,4-dihydro-2H-thiochromen-4-ylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43741509 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-(3,4-dihydro-2H-thiochromen-4-ylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(NC3CCSc4ccccc43)ccc2o1 |
| InChI | InChI=1S/C16H14N2O2S/c19-16-18-13-9-10(5-6-14(13)20-16)17-12-7-8-21-15-4-2-1-3-11(12)15/h1-6,9,12,17H,7-8H2,(H,18,19) |
| InChIKey | HHXIYKNHISWYBC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |