C14H12N2O4S2 — CID 43827194
2-[1-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid (PubChem CID 43827194) has the molecular formula C14H12N2O4S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[1-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid.
| Compound Name | 2-[1-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 43827194 |
| Molecular Formula | C14H12N2O4S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-[1-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccccc1SC1CC(=O)N(C2=NCCS2)C1=O |
| InChI | InChI=1S/C14H12N2O4S2/c17-11-7-10(12(18)16(11)14-15-5-6-21-14)22-9-4-2-1-3-8(9)13(19)20/h1-4,10H,5-7H2,(H,19,20) |
| InChIKey | HGAURNQUROBFKW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|