C26H23ClN4OS3 — CID 43842119
9-(4-chlorophenyl)-5-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 43842119) has the molecular formula C26H23ClN4OS3 and a molecular weight of 539.15 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-5-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | 9-(4-chlorophenyl)-5-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 43842119 |
| Molecular Formula | C26H23ClN4OS3 |
| Molecular Weight | 539.15 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 9-(4-chlorophenyl)-5-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | O=c1sc2c(n1Cc1n[nH]c(=S)n1-c1ccccc1)SC1C3CCC(C3)C1C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H23ClN4OS3/c27-17-10-8-14(9-11-17)20-21-15-6-7-16(12-15)22(21)34-24-23(20)35-26(32)30(24)13-19-28-29-25(33)31(19)18-4-2-1-3-5-18/h1-5,8-11,15-16,20-22H,6-7,12-13H2,(H,29,33) |
| InChIKey | OEABDGYVVMIOAD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.15 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|