C16H12N6O3S — CID 43864294
4-ethylsulfanyl-11-(4-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 43864294) has the molecular formula C16H12N6O3S and a molecular weight of 368.38 g/mol. Its IUPAC name is 4-ethylsulfanyl-11-(4-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-ethylsulfanyl-11-(4-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 43864294 |
| Molecular Formula | C16H12N6O3S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 4-ethylsulfanyl-11-(4-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CCSc1nc2ncc3c(=O)n(-c4ccc([N+](=O)[O-])cc4)ccc3n2n1 |
| InChI | InChI=1S/C16H12N6O3S/c1-2-26-16-18-15-17-9-12-13(21(15)19-16)7-8-20(14(12)23)10-3-5-11(6-4-10)22(24)25/h3-9H,2H2,1H3 |
| InChIKey | SCXRHZXMIMGACK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 108.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|